C40H40N4O2 — CID 58721243
N-[2,5-bis[2-(4-cyanophenyl)ethynyl]phenyl]-2-(2-methylprop-2-enoylamino)dodecanamide (PubChem CID 58721243) has the molecular formula C40H40N4O2 and a molecular weight of 608.79 g/mol. Its IUPAC name is N-[2,5-bis[2-(4-cyanophenyl)ethynyl]phenyl]-2-(2-methylprop-2-enoylamino)dodecanamide.
| Compound Name | N-[2,5-bis[2-(4-cyanophenyl)ethynyl]phenyl]-2-(2-methylprop-2-enoylamino)dodecanamide |
|---|---|
| PubChem CID | 58721243 |
| Molecular Formula | C40H40N4O2 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | N-[2,5-bis[2-(4-cyanophenyl)ethynyl]phenyl]-2-(2-methylprop-2-enoylamino)dodecanamide |
| SMILES | C=C(C)C(=O)NC(CCCCCCCCCC)C(=O)Nc1cc(C#Cc2ccc(C#N)cc2)ccc1C#Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C40H40N4O2/c1-4-5-6-7-8-9-10-11-12-37(43-39(45)30(2)3)40(46)44-38-27-33(18-13-31-14-19-34(28-41)20-15-31)24-26-36(38)25-23-32-16-21-35(29-42)22-17-32/h14-17,19-22,24,26-27,37H,2,4-12H2,1,3H3,(H,43,45)(H,44,46) |
| InChIKey | QOMKPGCKPRMNPM-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|