C38H38F2N2O10 — CID 58722182
methyl 2-[22-(2,7-difluoro-3,6-dihydroxy-3H-xanthen-9-yl)-18-(2-methoxy-2-oxoethyl)-8-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-12-yl]acetate (PubChem CID 58722182) has the molecular formula C38H38F2N2O10 and a molecular weight of 720.72 g/mol. Its IUPAC name is methyl 2-[22-(2,7-difluoro-3,6-dihydroxy-3H-xanthen-9-yl)-18-(2-methoxy-2-oxoethyl)-8-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-12-yl]acetate.
| Compound Name | methyl 2-[22-(2,7-difluoro-3,6-dihydroxy-3H-xanthen-9-yl)-18-(2-methoxy-2-oxoethyl)-8-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-12-yl]acetate |
|---|---|
| PubChem CID | 58722182 |
| Molecular Formula | C38H38F2N2O10 |
| Molecular Weight | 720.72 g/mol |
| Exact Mass | 720.25 |
| IUPAC Name | methyl 2-[22-(2,7-difluoro-3,6-dihydroxy-3H-xanthen-9-yl)-18-(2-methoxy-2-oxoethyl)-8-methyl-2,5,15-trioxa-12,18-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-12-yl]acetate |
| SMILES | COC(=O)CN1CCOCCN(CC(=O)OC)c2ccc(C3=C4C=C(F)C(O)C=C4Oc4cc(O)c(F)cc43)cc2OCCOc2cc(C)ccc21 |
| InChI | InChI=1S/C38H38F2N2O10/c1-22-4-6-28-34(14-22)50-12-13-51-35-15-23(38-24-16-26(39)30(43)18-32(24)52-33-19-31(44)27(40)17-25(33)38)5-7-29(35)42(21-37(46)48-3)9-11-49-10-8-41(28)20-36(45)47-2/h4-7,14-19,30,43-44H,8-13,20-21H2,1-3H3 |
| InChIKey | ZIDFJHGQKGTMKC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.72 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|