C25H31N5O3 — CID 58722307
1-[5-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenoxy]-5-methylhexyl]-3-pyridin-4-ylimidazolidin-2-one (PubChem CID 58722307) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 1-[5-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenoxy]-5-methylhexyl]-3-pyridin-4-ylimidazolidin-2-one.
| Compound Name | 1-[5-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenoxy]-5-methylhexyl]-3-pyridin-4-ylimidazolidin-2-one |
|---|---|
| PubChem CID | 58722307 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 1-[5-[4-(5-ethyl-1,2,4-oxadiazol-3-yl)phenoxy]-5-methylhexyl]-3-pyridin-4-ylimidazolidin-2-one |
| SMILES | CCc1nc(-c2ccc(OC(C)(C)CCCCN3CCN(c4ccncc4)C3=O)cc2)no1 |
| InChI | InChI=1S/C25H31N5O3/c1-4-22-27-23(28-33-22)19-7-9-21(10-8-19)32-25(2,3)13-5-6-16-29-17-18-30(24(29)31)20-11-14-26-15-12-20/h7-12,14-15H,4-6,13,16-18H2,1-3H3 |
| InChIKey | VLTSSWANSMYHHK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 84.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|