C39H33N3O — CID 58722470
N-[4-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenyl]acetamide (PubChem CID 58722470) has the molecular formula C39H33N3O and a molecular weight of 559.71 g/mol. Its IUPAC name is N-[4-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenyl]acetamide.
| Compound Name | N-[4-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenyl]acetamide |
|---|---|
| PubChem CID | 58722470 |
| Molecular Formula | C39H33N3O |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | N-[4-(N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]anilino)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4cccc(C)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H33N3O/c1-29-10-9-15-39(28-29)42(35-13-7-4-8-14-35)37-24-18-32(19-25-37)31-16-22-36(23-17-31)41(34-11-5-3-6-12-34)38-26-20-33(21-27-38)40-30(2)43/h3-28H,1-2H3,(H,40,43) |
| InChIKey | MLULOKXNEZFCNN-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |