C25H34N2O5 — CID 58723293
2-hydroxy-N-[1-[2-hydroxy-3-[4-(3-phenylpropoxy)phenoxy]propyl]piperidin-4-yl]acetamide (PubChem CID 58723293) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-hydroxy-N-[1-[2-hydroxy-3-[4-(3-phenylpropoxy)phenoxy]propyl]piperidin-4-yl]acetamide.
| Compound Name | 2-hydroxy-N-[1-[2-hydroxy-3-[4-(3-phenylpropoxy)phenoxy]propyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 58723293 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 2-hydroxy-N-[1-[2-hydroxy-3-[4-(3-phenylpropoxy)phenoxy]propyl]piperidin-4-yl]acetamide |
| SMILES | O=C(CO)NC1CCN(CC(O)COc2ccc(OCCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H34N2O5/c28-18-25(30)26-21-12-14-27(15-13-21)17-22(29)19-32-24-10-8-23(9-11-24)31-16-4-7-20-5-2-1-3-6-20/h1-3,5-6,8-11,21-22,28-29H,4,7,12-19H2,(H,26,30) |
| InChIKey | CGVWZVBAQYAFIG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|