C9H11NO2S — CID 58724865
5-formyl-N,N,2-trimethylthiophene-3-carboxamide (PubChem CID 58724865) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 5-formyl-N,N,2-trimethylthiophene-3-carboxamide.
| Compound Name | 5-formyl-N,N,2-trimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 58724865 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 5-formyl-N,N,2-trimethylthiophene-3-carboxamide |
| SMILES | Cc1sc(C=O)cc1C(=O)N(C)C |
| InChI | InChI=1S/C9H11NO2S/c1-6-8(9(12)10(2)3)4-7(5-11)13-6/h4-5H,1-3H3 |
| InChIKey | VMSCXWVGVNVXRP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|