C9H10N2O2S — CID 12548165
N'-(3,5-diformylthiophen-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 12548165) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is N'-(3,5-diformylthiophen-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(3,5-diformylthiophen-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 12548165 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | N'-(3,5-diformylthiophen-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1sc(C=O)cc1C=O |
| InChI | InChI=1S/C9H10N2O2S/c1-11(2)6-10-9-7(4-12)3-8(5-13)14-9/h3-6H,1-2H3/b10-6+ |
| InChIKey | FXNNJSAKTPGMOJ-UXBLZVDNSA-N |
| XLogP | 1.59 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|