C7H6N2O2S — CID 169408596
3-[(E)-hydrazinylidenemethyl]thiophene-2,5-dicarbaldehyde (PubChem CID 169408596) has the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. Its IUPAC name is 3-[(E)-hydrazinylidenemethyl]thiophene-2,5-dicarbaldehyde.
| Compound Name | 3-[(E)-hydrazinylidenemethyl]thiophene-2,5-dicarbaldehyde |
|---|---|
| PubChem CID | 169408596 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 3-[(E)-hydrazinylidenemethyl]thiophene-2,5-dicarbaldehyde |
| SMILES | N/N=C/c1cc(C=O)sc1C=O |
| InChI | InChI=1S/C7H6N2O2S/c8-9-2-5-1-6(3-10)12-7(5)4-11/h1-4H,8H2/b9-2+ |
| InChIKey | DWHNLLMFAUFYGK-XNWCZRBMSA-N |
| XLogP | 0.67 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|