C6H5BO4S — CID 71732284
(2,5-diformylthiophen-3-yl)boronic acid (PubChem CID 71732284) has the molecular formula C6H5BO4S and a molecular weight of 183.98 g/mol. Its IUPAC name is (2,5-diformylthiophen-3-yl)boronic acid.
| Compound Name | (2,5-diformylthiophen-3-yl)boronic acid |
|---|---|
| PubChem CID | 71732284 |
| Molecular Formula | C6H5BO4S |
| Molecular Weight | 183.98 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | (2,5-diformylthiophen-3-yl)boronic acid |
| SMILES | O=Cc1cc(B(O)O)c(C=O)s1 |
| InChI | InChI=1S/C6H5BO4S/c8-2-4-1-5(7(10)11)6(3-9)12-4/h1-3,10-11H |
| InChIKey | MUFMXOGQGGNMRX-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.98 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|