(2,5-diformylthiophen-3-yl)boronic acid

C6H5BO4S — CID 71732284

IUPAC(2,5-diformylthiophen-3-yl)boronic acid
SMILESO=Cc1cc(B(O)O)c(C=O)s1
InChIInChI=1S/C6H5BO4S/c8-2-4-1-5(7(10)11)6(3-9)12-4/h1-3,10-11H
InChIKeyMUFMXOGQGGNMRX-UHFFFAOYSA-N
MW183.98 g/mol
LogP-0.95
Rot. Bonds3

About (2,5-diformylthiophen-3-yl)boronic acid

(2,5-diformylthiophen-3-yl)boronic acid (PubChem CID 71732284) has the molecular formula C6H5BO4S and a molecular weight of 183.98 g/mol. Its IUPAC name is (2,5-diformylthiophen-3-yl)boronic acid.

Molecular Properties

Compound Name(2,5-diformylthiophen-3-yl)boronic acid
PubChem CID71732284
Molecular FormulaC6H5BO4S
Molecular Weight183.98 g/mol
Exact Mass184.00
IUPAC Name(2,5-diformylthiophen-3-yl)boronic acid
SMILESO=Cc1cc(B(O)O)c(C=O)s1
InChIInChI=1S/C6H5BO4S/c8-2-4-1-5(7(10)11)6(3-9)12-4/h1-3,10-11H
InChIKeyMUFMXOGQGGNMRX-UHFFFAOYSA-N
XLogP-0.95
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.98
LogP ≤ 5-0.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2,5-diformylthiophen-3-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,5-diformylthiophen-3-yl)boronic acid?
The IUPAC name of (2,5-diformylthiophen-3-yl)boronic acid (CID 71732284) is (2,5-diformylthiophen-3-yl)boronic acid.
What is the SMILES notation for (2,5-diformylthiophen-3-yl)boronic acid?
The canonical SMILES for (2,5-diformylthiophen-3-yl)boronic acid is O=Cc1cc(B(O)O)c(C=O)s1.
What is the InChIKey of (2,5-diformylthiophen-3-yl)boronic acid?
The InChIKey is MUFMXOGQGGNMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BO4S/c8-2-4-1-5(7(10)11)6(3-9)12-4/h1-3,10-11H.
What are the key properties of (2,5-diformylthiophen-3-yl)boronic acid?
(2,5-diformylthiophen-3-yl)boronic acid has a molecular weight of 183.98 g/mol, XLogP of -0.95, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-diformylthiophen-3-yl)boronic acid is sourced from PubChem (CID 71732284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).