C10H9F3O3S — CID 165449578
5-formyl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)thiophene-2-carboxylic acid (PubChem CID 165449578) has the molecular formula C10H9F3O3S and a molecular weight of 266.24 g/mol. Its IUPAC name is 5-formyl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)thiophene-2-carboxylic acid.
| Compound Name | 5-formyl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 165449578 |
| Molecular Formula | C10H9F3O3S |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 5-formyl-3-(1,1,1-trifluoro-2-methylpropan-2-yl)thiophene-2-carboxylic acid |
| SMILES | CC(C)(c1cc(C=O)sc1C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O3S/c1-9(2,10(11,12)13)6-3-5(4-14)17-7(6)8(15)16/h3-4H,1-2H3,(H,15,16) |
| InChIKey | YBZQTFBIIAVBFW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|