C11H10N2O2S — CID 143431607
4-(dimethylamino)thieno[2,3-b]pyridine-2,5-dicarbaldehyde (PubChem CID 143431607) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-(dimethylamino)thieno[2,3-b]pyridine-2,5-dicarbaldehyde.
| Compound Name | 4-(dimethylamino)thieno[2,3-b]pyridine-2,5-dicarbaldehyde |
|---|---|
| PubChem CID | 143431607 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4-(dimethylamino)thieno[2,3-b]pyridine-2,5-dicarbaldehyde |
| SMILES | CN(C)c1c(C=O)cnc2sc(C=O)cc12 |
| InChI | InChI=1S/C11H10N2O2S/c1-13(2)10-7(5-14)4-12-11-9(10)3-8(6-15)16-11/h3-6H,1-2H3 |
| InChIKey | JXAOFXFHDGABGA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|