C13H21N3O2S — CID 143159716
4-(dimethylamino)thieno[2,3-b]pyridine-2-carbaldehyde;methanamine;methoxymethane (PubChem CID 143159716) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 4-(dimethylamino)thieno[2,3-b]pyridine-2-carbaldehyde;methanamine;methoxymethane.
| Compound Name | 4-(dimethylamino)thieno[2,3-b]pyridine-2-carbaldehyde;methanamine;methoxymethane |
|---|---|
| PubChem CID | 143159716 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-(dimethylamino)thieno[2,3-b]pyridine-2-carbaldehyde;methanamine;methoxymethane |
| SMILES | CN.CN(C)c1ccnc2sc(C=O)cc12.COC |
| InChI | InChI=1S/C10H10N2OS.C2H6O.CH5N/c1-12(2)9-3-4-11-10-8(9)5-7(6-13)14-10;1-3-2;1-2/h3-6H,1-2H3;1-2H3;2H2,1H3 |
| InChIKey | IVLFTCKLZOEVMS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|