C18H21N3O2S — CID 143159947
4-(dimethylamino)-N-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 143159947) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-(dimethylamino)-N-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143159947 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-(dimethylamino)-N-[(3E,5Z)-7-methoxyhepta-1,3,5-trien-4-yl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | C=C/C=C(\C=C/COC)NC(=O)c1cc2c(N(C)C)ccnc2s1 |
| InChI | InChI=1S/C18H21N3O2S/c1-5-7-13(8-6-11-23-4)20-17(22)16-12-14-15(21(2)3)9-10-19-18(14)24-16/h5-10,12H,1,11H2,2-4H3,(H,20,22)/b8-6-,13-7+ |
| InChIKey | IMWCPQLRUBWAIJ-WNDPTYLVSA-N |
| XLogP | 3.36 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|