C22H30N4OS — CID 143487681
but-1-ene;4-(dimethylamino)-6-ethyl-N-methanimidoyl-N-[(2E)-penta-2,4-dien-2-yl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 143487681) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is but-1-ene;4-(dimethylamino)-6-ethyl-N-methanimidoyl-N-[(2E)-penta-2,4-dien-2-yl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | but-1-ene;4-(dimethylamino)-6-ethyl-N-methanimidoyl-N-[(2E)-penta-2,4-dien-2-yl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143487681 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | but-1-ene;4-(dimethylamino)-6-ethyl-N-methanimidoyl-N-[(2E)-penta-2,4-dien-2-yl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | C=CCC.[H]/N=C/N(C(=O)c1cc2c(N(C)C)cc(CC)nc2s1)/C(C)=C/C=C |
| InChI | InChI=1S/C18H22N4OS.C4H8/c1-6-8-12(3)22(11-19)18(23)16-10-14-15(21(4)5)9-13(7-2)20-17(14)24-16;1-3-4-2/h6,8-11,19H,1,7H2,2-5H3;3H,1,4H2,2H3/b12-8+,19-11+; |
| InChIKey | KONMRRGMZDNVAS-CRVKQQKCSA-N |
| XLogP | 5.65 |
| TPSA | 60.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|