C17H23N5OS — CID 143160569
N-[(E)-but-2-en-2-yl]-4-[2-(dimethylamino)ethylamino]-N-methanimidoylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 143160569) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is N-[(E)-but-2-en-2-yl]-4-[2-(dimethylamino)ethylamino]-N-methanimidoylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-[(E)-but-2-en-2-yl]-4-[2-(dimethylamino)ethylamino]-N-methanimidoylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143160569 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-[(E)-but-2-en-2-yl]-4-[2-(dimethylamino)ethylamino]-N-methanimidoylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | [H]/N=C/N(C(=O)c1cc2c(NCCN(C)C)ccnc2s1)/C(C)=C/C |
| InChI | InChI=1S/C17H23N5OS/c1-5-12(2)22(11-18)17(23)15-10-13-14(19-8-9-21(3)4)6-7-20-16(13)24-15/h5-7,10-11,18H,8-9H2,1-4H3,(H,19,20)/b12-5+,18-11+ |
| InChIKey | WYUZGWOIVCHJRW-AYUQCOQNSA-N |
| XLogP | 3.24 |
| TPSA | 72.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|