C23H32N4O3S — CID 143488117
acetylene;N-methanimidoyl-4-(2-methoxyethylamino)-N-[(E)-prop-1-enyl]thieno[2,3-b]pyridine-2-carboxamide;(Z)-1-methoxypent-2-ene (PubChem CID 143488117) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is acetylene;N-methanimidoyl-4-(2-methoxyethylamino)-N-[(E)-prop-1-enyl]thieno[2,3-b]pyridine-2-carboxamide;(Z)-1-methoxypent-2-ene.
| Compound Name | acetylene;N-methanimidoyl-4-(2-methoxyethylamino)-N-[(E)-prop-1-enyl]thieno[2,3-b]pyridine-2-carboxamide;(Z)-1-methoxypent-2-ene |
|---|---|
| PubChem CID | 143488117 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | acetylene;N-methanimidoyl-4-(2-methoxyethylamino)-N-[(E)-prop-1-enyl]thieno[2,3-b]pyridine-2-carboxamide;(Z)-1-methoxypent-2-ene |
| SMILES | C#C.CC/C=C\COC.[H]/N=C/N(/C=C/C)C(=O)c1cc2c(NCCOC)ccnc2s1 |
| InChI | InChI=1S/C15H18N4O2S.C6H12O.C2H2/c1-3-7-19(10-16)15(20)13-9-11-12(17-6-8-21-2)4-5-18-14(11)22-13;1-3-4-5-6-7-2;1-2/h3-5,7,9-10,16H,6,8H2,1-2H3,(H,17,18);4-5H,3,6H2,1-2H3;1-2H/b7-3+,16-10+;5-4-; |
| InChIKey | QORSSFNUDUPDTQ-RFXPTHDMSA-N |
| XLogP | 4.79 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|