C8H7N3O2S — CID 82395158
2-amino-4-methoxythieno[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 82395158) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 2-amino-4-methoxythieno[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 2-amino-4-methoxythieno[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 82395158 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-amino-4-methoxythieno[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | COc1nc(N)nc2sc(C=O)cc12 |
| InChI | InChI=1S/C8H7N3O2S/c1-13-6-5-2-4(3-12)14-7(5)11-8(9)10-6/h2-3H,1H3,(H2,9,10,11) |
| InChIKey | NYMHHJJDPGYQSI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|