C16H18N4O2S — CID 143009743
2-amino-4-(benzylamino)thieno[2,3-d]pyrimidine-6-carbaldehyde;methoxymethane (PubChem CID 143009743) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-amino-4-(benzylamino)thieno[2,3-d]pyrimidine-6-carbaldehyde;methoxymethane.
| Compound Name | 2-amino-4-(benzylamino)thieno[2,3-d]pyrimidine-6-carbaldehyde;methoxymethane |
|---|---|
| PubChem CID | 143009743 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-amino-4-(benzylamino)thieno[2,3-d]pyrimidine-6-carbaldehyde;methoxymethane |
| SMILES | COC.Nc1nc(NCc2ccccc2)c2cc(C=O)sc2n1 |
| InChI | InChI=1S/C14H12N4OS.C2H6O/c15-14-17-12(16-7-9-4-2-1-3-5-9)11-6-10(8-19)20-13(11)18-14;1-3-2/h1-6,8H,7H2,(H3,15,16,17,18);1-2H3 |
| InChIKey | KTBGJCCWMPMRMQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|