C24H38N4OS — CID 143159758
ethane;N'-[(2E,4Z)-hepta-2,4-dien-3-yl]propanimidamide;4-[methyl(propyl)amino]thieno[2,3-b]pyridine-2-carbaldehyde (PubChem CID 143159758) has the molecular formula C24H38N4OS and a molecular weight of 430.66 g/mol. Its IUPAC name is ethane;N'-[(2E,4Z)-hepta-2,4-dien-3-yl]propanimidamide;4-[methyl(propyl)amino]thieno[2,3-b]pyridine-2-carbaldehyde.
| Compound Name | ethane;N'-[(2E,4Z)-hepta-2,4-dien-3-yl]propanimidamide;4-[methyl(propyl)amino]thieno[2,3-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 143159758 |
| Molecular Formula | C24H38N4OS |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | ethane;N'-[(2E,4Z)-hepta-2,4-dien-3-yl]propanimidamide;4-[methyl(propyl)amino]thieno[2,3-b]pyridine-2-carbaldehyde |
| SMILES | C/C=C(\C=C/CC)/N=C(/N)CC.CC.CCCN(C)c1ccnc2sc(C=O)cc12 |
| InChI | InChI=1S/C12H14N2OS.C10H18N2.C2H6/c1-3-6-14(2)11-4-5-13-12-10(11)7-9(8-15)16-12;1-4-7-8-9(5-2)12-10(11)6-3;1-2/h4-5,7-8H,3,6H2,1-2H3;5,7-8H,4,6H2,1-3H3,(H2,11,12);1-2H3/b;8-7-,9-5+; |
| InChIKey | DHVPRUMAOPQMMG-IGZJSVATSA-N |
| XLogP | 6.60 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|