C11H18N2OS — CID 62751473
2-[3,3-dimethylbutan-2-yl(methyl)amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 62751473) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-[3,3-dimethylbutan-2-yl(methyl)amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[3,3-dimethylbutan-2-yl(methyl)amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62751473 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-[3,3-dimethylbutan-2-yl(methyl)amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | CC(N(C)c1ncc(C=O)s1)C(C)(C)C |
| InChI | InChI=1S/C11H18N2OS/c1-8(11(2,3)4)13(5)10-12-6-9(7-14)15-10/h6-8H,1-5H3 |
| InChIKey | HBKGQVHZBDYFDI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|