C10H11N3OS2 — CID 62750633
2-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 62750633) has the molecular formula C10H11N3OS2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62750633 |
| Molecular Formula | C10H11N3OS2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1nc(CN(C)c2ncc(C=O)s2)cs1 |
| InChI | InChI=1S/C10H11N3OS2/c1-7-12-8(6-15-7)4-13(2)10-11-3-9(5-14)16-10/h3,5-6H,4H2,1-2H3 |
| InChIKey | ZKKRJEVCXQKLRC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|