C13H16BrN3S — CID 107082345
5-(bromomethyl)-N,3-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-amine (PubChem CID 107082345) has the molecular formula C13H16BrN3S and a molecular weight of 326.26 g/mol. Its IUPAC name is 5-(bromomethyl)-N,3-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-amine.
| Compound Name | 5-(bromomethyl)-N,3-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 107082345 |
| Molecular Formula | C13H16BrN3S |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 5-(bromomethyl)-N,3-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-amine |
| SMILES | Cc1nc(CN(C)c2ncc(CBr)cc2C)cs1 |
| InChI | InChI=1S/C13H16BrN3S/c1-9-4-11(5-14)6-15-13(9)17(3)7-12-8-18-10(2)16-12/h4,6,8H,5,7H2,1-3H3 |
| InChIKey | GRDYTZDJBKNGOY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|