C13H14BrClN2S — CID 107081351
5-(bromomethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethylpyridin-2-amine (PubChem CID 107081351) has the molecular formula C13H14BrClN2S and a molecular weight of 345.69 g/mol. Its IUPAC name is 5-(bromomethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethylpyridin-2-amine.
| Compound Name | 5-(bromomethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 107081351 |
| Molecular Formula | C13H14BrClN2S |
| Molecular Weight | 345.69 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 5-(bromomethyl)-N-[(5-chlorothiophen-2-yl)methyl]-N,3-dimethylpyridin-2-amine |
| SMILES | Cc1cc(CBr)cnc1N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H14BrClN2S/c1-9-5-10(6-14)7-16-13(9)17(2)8-11-3-4-12(15)18-11/h3-5,7H,6,8H2,1-2H3 |
| InChIKey | XPVRMJCOTNIQGA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.69 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|