C11H11N3OS — CID 62756167
2-[methyl(pyridin-4-ylmethyl)amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 62756167) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 2-[methyl(pyridin-4-ylmethyl)amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[methyl(pyridin-4-ylmethyl)amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62756167 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-[methyl(pyridin-4-ylmethyl)amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | CN(Cc1ccncc1)c1ncc(C=O)s1 |
| InChI | InChI=1S/C11H11N3OS/c1-14(7-9-2-4-12-5-3-9)11-13-6-10(8-15)16-11/h2-6,8H,7H2,1H3 |
| InChIKey | LXWAYGVFQMUDPX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|