C11H18N2O2S — CID 62750121
2-[2-methoxyethyl(2-methylpropyl)amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 62750121) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-[2-methoxyethyl(2-methylpropyl)amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[2-methoxyethyl(2-methylpropyl)amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62750121 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-[2-methoxyethyl(2-methylpropyl)amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | COCCN(CC(C)C)c1ncc(C=O)s1 |
| InChI | InChI=1S/C11H18N2O2S/c1-9(2)7-13(4-5-15-3)11-12-6-10(8-14)16-11/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | MBWPNQYQULXOPZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|