C23H34O2 — CID 58725461
4-[(17S)-10,13-dimethyl-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoic acid (PubChem CID 58725461) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 4-[(17S)-10,13-dimethyl-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoic acid.
| Compound Name | 4-[(17S)-10,13-dimethyl-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoic acid |
|---|---|
| PubChem CID | 58725461 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 4-[(17S)-10,13-dimethyl-2,5,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butanoic acid |
| SMILES | CC12CCC=CC1C=CC1C2CCC2(C)C1CC[C@@H]2CCCC(=O)O |
| InChI | InChI=1S/C23H34O2/c1-22-14-4-3-6-16(22)9-11-18-19-12-10-17(7-5-8-21(24)25)23(19,2)15-13-20(18)22/h3,6,9,11,16-20H,4-5,7-8,10,12-15H2,1-2H3,(H,24,25)/t16?,17-,18?,19?,20?,22?,23?/m0/s1 |
| InChIKey | AXRXMNWCJWBJIJ-DNBWQTMUSA-N |
| XLogP | 5.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|