C23H35F3O2 — CID 145266266
4-[(8S)-3,7,7-trifluoro-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoic acid (PubChem CID 145266266) has the molecular formula C23H35F3O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 4-[(8S)-3,7,7-trifluoro-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoic acid.
| Compound Name | 4-[(8S)-3,7,7-trifluoro-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoic acid |
|---|---|
| PubChem CID | 145266266 |
| Molecular Formula | C23H35F3O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 4-[(8S)-3,7,7-trifluoro-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoic acid |
| SMILES | CC12CCC3[C@H](C1CCC2CCCC(=O)O)C(F)(F)CC1CC(F)CCC13C |
| InChI | InChI=1S/C23H35F3O2/c1-21-11-9-18-20(17(21)7-6-14(21)4-3-5-19(27)28)23(25,26)13-15-12-16(24)8-10-22(15,18)2/h14-18,20H,3-13H2,1-2H3,(H,27,28)/t14?,15?,16?,17?,18?,20-,21?,22?/m0/s1 |
| InChIKey | HBUJJYVXKWHZKW-QMPAGPNCSA-N |
| XLogP | 6.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |