C23H32F6O2 — CID 145266311
4-(3,3,7,7,12,12-hexafluoro-10,13-dimethyl-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoic acid (PubChem CID 145266311) has the molecular formula C23H32F6O2 and a molecular weight of 454.50 g/mol. Its IUPAC name is 4-(3,3,7,7,12,12-hexafluoro-10,13-dimethyl-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoic acid.
| Compound Name | 4-(3,3,7,7,12,12-hexafluoro-10,13-dimethyl-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoic acid |
|---|---|
| PubChem CID | 145266311 |
| Molecular Formula | C23H32F6O2 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 4-(3,3,7,7,12,12-hexafluoro-10,13-dimethyl-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoic acid |
| SMILES | CC12CCC(F)(F)CC1CC(F)(F)C1C2CC(F)(F)C2(C)C(CCCC(=O)O)CCC12 |
| InChI | InChI=1S/C23H32F6O2/c1-19-8-9-21(24,25)10-14(19)11-22(26,27)18-15-7-6-13(4-3-5-17(30)31)20(15,2)23(28,29)12-16(18)19/h13-16,18H,3-12H2,1-2H3,(H,30,31) |
| InChIKey | ZYTTUOYGRYKVNG-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |