C39H45N5O7 — CID 58726045
(2R)-1-[(2S)-2-[[(2R)-2-[[(2S)-2-amino-6-benzoyloxyhexanoyl]amino]-3-(1-methylindol-2-yl)propanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 58726045) has the molecular formula C39H45N5O7 and a molecular weight of 695.82 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-[[(2R)-2-[[(2S)-2-amino-6-benzoyloxyhexanoyl]amino]-3-(1-methylindol-2-yl)propanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(2S)-2-[[(2R)-2-[[(2S)-2-amino-6-benzoyloxyhexanoyl]amino]-3-(1-methylindol-2-yl)propanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58726045 |
| Molecular Formula | C39H45N5O7 |
| Molecular Weight | 695.82 g/mol |
| Exact Mass | 695.33 |
| IUPAC Name | (2R)-1-[(2S)-2-[[(2R)-2-[[(2S)-2-amino-6-benzoyloxyhexanoyl]amino]-3-(1-methylindol-2-yl)propanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cn1c(C[C@@H](NC(=O)[C@@H](N)CCCCOC(=O)c2ccccc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N2CCC[C@@H]2C(=O)O)cc2ccccc21 |
| InChI | InChI=1S/C39H45N5O7/c1-43-29(24-28-17-8-9-19-33(28)43)25-31(41-35(45)30(40)18-10-11-22-51-39(50)27-15-6-3-7-16-27)36(46)42-32(23-26-13-4-2-5-14-26)37(47)44-21-12-20-34(44)38(48)49/h2-9,13-17,19,24,30-32,34H,10-12,18,20-23,25,40H2,1H3,(H,41,45)(H,42,46)(H,48,49)/t30-,31+,32-,34+/m0/s1 |
| InChIKey | KWRCUQJOZRYKMI-BVTPXELJSA-N |
| XLogP | 3.36 |
| TPSA | 173.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|