C22H23N3O3 — CID 58727058
3-(3H-isoindol-1-ylamino)propyl 5-oxo-1-phenylpyrrolidine-3-carboxylate (PubChem CID 58727058) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-(3H-isoindol-1-ylamino)propyl 5-oxo-1-phenylpyrrolidine-3-carboxylate.
| Compound Name | 3-(3H-isoindol-1-ylamino)propyl 5-oxo-1-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 58727058 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-(3H-isoindol-1-ylamino)propyl 5-oxo-1-phenylpyrrolidine-3-carboxylate |
| SMILES | O=C(OCCCNC1=NCc2ccccc21)C1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C22H23N3O3/c26-20-13-17(15-25(20)18-8-2-1-3-9-18)22(27)28-12-6-11-23-21-19-10-5-4-7-16(19)14-24-21/h1-5,7-10,17H,6,11-15H2,(H,23,24) |
| InChIKey | XXPLPZANIYPAQO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|