C22H22N4O5 — CID 58727010
3-(3H-isoindol-1-ylamino)propyl 1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 58727010) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 3-(3H-isoindol-1-ylamino)propyl 1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | 3-(3H-isoindol-1-ylamino)propyl 1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 58727010 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-(3H-isoindol-1-ylamino)propyl 1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(OCCCNC1=NCc2ccccc21)C1CC(=O)N(c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C22H22N4O5/c27-20-11-16(14-25(20)17-6-3-7-18(12-17)26(29)30)22(28)31-10-4-9-23-21-19-8-2-1-5-15(19)13-24-21/h1-3,5-8,12,16H,4,9-11,13-14H2,(H,23,24) |
| InChIKey | GWTKYVZKFWZPPZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|