C40H44O6 — CID 58729414
1-O-[4-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-O-[4-[(E)-2-(3-hydroxyphenyl)ethenyl]phenyl] butanedioate (PubChem CID 58729414) has the molecular formula C40H44O6 and a molecular weight of 620.79 g/mol. Its IUPAC name is 1-O-[4-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-O-[4-[(E)-2-(3-hydroxyphenyl)ethenyl]phenyl] butanedioate.
| Compound Name | 1-O-[4-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-O-[4-[(E)-2-(3-hydroxyphenyl)ethenyl]phenyl] butanedioate |
|---|---|
| PubChem CID | 58729414 |
| Molecular Formula | C40H44O6 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | 1-O-[4-[(1E,3E,5E,7E,9E)-3,7-dimethylundeca-1,3,5,7,9-pentaenyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] 4-O-[4-[(E)-2-(3-hydroxyphenyl)ethenyl]phenyl] butanedioate |
| SMILES | C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(=O)C(OC(=O)CCC(=O)Oc2ccc(/C=C/c3cccc(O)c3)cc2)CC1(C)C |
| InChI | InChI=1S/C40H44O6/c1-7-8-11-28(2)12-9-13-29(3)16-23-35-30(4)39(44)36(27-40(35,5)6)46-38(43)25-24-37(42)45-34-21-19-31(20-22-34)17-18-32-14-10-15-33(41)26-32/h7-23,26,36,41H,24-25,27H2,1-6H3/b8-7+,12-9+,18-17+,23-16+,28-11+,29-13+ |
| InChIKey | CPENNAINHCFZRM-BYHRXGBFSA-N |
| XLogP | 9.06 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|