C21H30O4 — CID 72650022
[3,5,5-trimethyl-4-(3-methylhepta-1,3,5-trienyl)-2-oxocyclohex-3-en-1-yl] 4-hydroxybutanoate (PubChem CID 72650022) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [3,5,5-trimethyl-4-(3-methylhepta-1,3,5-trienyl)-2-oxocyclohex-3-en-1-yl] 4-hydroxybutanoate.
| Compound Name | [3,5,5-trimethyl-4-(3-methylhepta-1,3,5-trienyl)-2-oxocyclohex-3-en-1-yl] 4-hydroxybutanoate |
|---|---|
| PubChem CID | 72650022 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [3,5,5-trimethyl-4-(3-methylhepta-1,3,5-trienyl)-2-oxocyclohex-3-en-1-yl] 4-hydroxybutanoate |
| SMILES | CC=CC=C(C)C=CC1=C(C)C(=O)C(OC(=O)CCCO)CC1(C)C |
| InChI | InChI=1S/C21H30O4/c1-6-7-9-15(2)11-12-17-16(3)20(24)18(14-21(17,4)5)25-19(23)10-8-13-22/h6-7,9,11-12,18,22H,8,10,13-14H2,1-5H3 |
| InChIKey | AWNULVZBZDVQKL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|