C29H44O9 — CID 58758161
1-O-(2,3,4,5-tetrahydroxyheptyl) 4-O-[3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylocta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] butanedioate (PubChem CID 58758161) has the molecular formula C29H44O9 and a molecular weight of 536.66 g/mol. Its IUPAC name is 1-O-(2,3,4,5-tetrahydroxyheptyl) 4-O-[3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylocta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] butanedioate.
| Compound Name | 1-O-(2,3,4,5-tetrahydroxyheptyl) 4-O-[3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylocta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] butanedioate |
|---|---|
| PubChem CID | 58758161 |
| Molecular Formula | C29H44O9 |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | 1-O-(2,3,4,5-tetrahydroxyheptyl) 4-O-[3,5,5-trimethyl-4-[(1E,3E,5E)-3-methylocta-1,3,5-trienyl]-2-oxocyclohex-3-en-1-yl] butanedioate |
| SMILES | CC/C=C/C=C(C)/C=C/C1=C(C)C(=O)C(OC(=O)CCC(=O)OCC(O)C(O)C(O)C(O)CC)CC1(C)C |
| InChI | InChI=1S/C29H44O9/c1-7-9-10-11-18(3)12-13-20-19(4)26(34)23(16-29(20,5)6)38-25(33)15-14-24(32)37-17-22(31)28(36)27(35)21(30)8-2/h9-13,21-23,27-28,30-31,35-36H,7-8,14-17H2,1-6H3/b10-9+,13-12+,18-11+ |
| InChIKey | AZIXAFHBUWWIPV-GPFOKXNUSA-N |
| XLogP | 2.86 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|