C23H36O9 — CID 59993082
1-O-(2,3,4,5-tetrahydroxyheptyl) 4-O-[3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] butanedioate (PubChem CID 59993082) has the molecular formula C23H36O9 and a molecular weight of 456.53 g/mol. Its IUPAC name is 1-O-(2,3,4,5-tetrahydroxyheptyl) 4-O-[3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] butanedioate.
| Compound Name | 1-O-(2,3,4,5-tetrahydroxyheptyl) 4-O-[3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] butanedioate |
|---|---|
| PubChem CID | 59993082 |
| Molecular Formula | C23H36O9 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1-O-(2,3,4,5-tetrahydroxyheptyl) 4-O-[3,5,5-trimethyl-2-oxo-4-[(E)-prop-1-enyl]cyclohex-3-en-1-yl] butanedioate |
| SMILES | C/C=C/C1=C(C)C(=O)C(OC(=O)CCC(=O)OCC(O)C(O)C(O)C(O)CC)CC1(C)C |
| InChI | InChI=1S/C23H36O9/c1-6-8-14-13(3)20(28)17(11-23(14,4)5)32-19(27)10-9-18(26)31-12-16(25)22(30)21(29)15(24)7-2/h6,8,15-17,21-22,24-25,29-30H,7,9-12H2,1-5H3/b8-6+ |
| InChIKey | YJWWCNFJRKJQAA-SOFGYWHQSA-N |
| XLogP | 0.97 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |