C19H30O5 — CID 59256113
[3,5,5-trimethyl-4-(2-methylprop-1-enyl)-2-oxocyclohex-3-en-1-yl] 2,2-diethoxyacetate (PubChem CID 59256113) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is [3,5,5-trimethyl-4-(2-methylprop-1-enyl)-2-oxocyclohex-3-en-1-yl] 2,2-diethoxyacetate.
| Compound Name | [3,5,5-trimethyl-4-(2-methylprop-1-enyl)-2-oxocyclohex-3-en-1-yl] 2,2-diethoxyacetate |
|---|---|
| PubChem CID | 59256113 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [3,5,5-trimethyl-4-(2-methylprop-1-enyl)-2-oxocyclohex-3-en-1-yl] 2,2-diethoxyacetate |
| SMILES | CCOC(OCC)C(=O)OC1CC(C)(C)C(C=C(C)C)=C(C)C1=O |
| InChI | InChI=1S/C19H30O5/c1-8-22-18(23-9-2)17(21)24-15-11-19(6,7)14(10-12(3)4)13(5)16(15)20/h10,15,18H,8-9,11H2,1-7H3 |
| InChIKey | CSOVSTYFGTVTKB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|