C41H50O10 — CID 91206754
1-O-[(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] 4-O-[3,5,5-trimethyl-2-oxo-4-(3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl)cyclohex-3-en-1-yl] butanedioate (PubChem CID 91206754) has the molecular formula C41H50O10 and a molecular weight of 702.84 g/mol. Its IUPAC name is 1-O-[(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] 4-O-[3,5,5-trimethyl-2-oxo-4-(3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl)cyclohex-3-en-1-yl] butanedioate.
| Compound Name | 1-O-[(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] 4-O-[3,5,5-trimethyl-2-oxo-4-(3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl)cyclohex-3-en-1-yl] butanedioate |
|---|---|
| PubChem CID | 91206754 |
| Molecular Formula | C41H50O10 |
| Molecular Weight | 702.84 g/mol |
| Exact Mass | 702.34 |
| IUPAC Name | 1-O-[(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] 4-O-[3,5,5-trimethyl-2-oxo-4-(3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl)cyclohex-3-en-1-yl] butanedioate |
| SMILES | C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)C(=O)C(OC(=O)CCC(=O)OC[C@H](O)[C@H]2OC(=O)C(O)C2=O)CC1(C)C |
| InChI | InChI=1S/C41H50O10/c1-9-26(2)16-12-17-27(3)14-10-11-15-28(4)18-13-19-29(5)20-21-31-30(6)36(45)33(24-41(31,7)8)50-35(44)23-22-34(43)49-25-32(42)39-37(46)38(47)40(48)51-39/h9-21,32-33,38-39,42,47H,1,22-25H2,2-8H3/t32-,33?,38?,39+/m0/s1 |
| InChIKey | OUFQVQZOUPQHJS-ZHMYQKPUSA-N |
| XLogP | 5.95 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.84 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|