C24H33O10P — CID 91365495
[(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] [3,5,5-trimethyl-4-(3-methylocta-1,3,5-trienyl)-2-oxocyclohex-3-en-1-yl] hydrogen phosphate (PubChem CID 91365495) has the molecular formula C24H33O10P and a molecular weight of 512.49 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] [3,5,5-trimethyl-4-(3-methylocta-1,3,5-trienyl)-2-oxocyclohex-3-en-1-yl] hydrogen phosphate.
| Compound Name | [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] [3,5,5-trimethyl-4-(3-methylocta-1,3,5-trienyl)-2-oxocyclohex-3-en-1-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 91365495 |
| Molecular Formula | C24H33O10P |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] [3,5,5-trimethyl-4-(3-methylocta-1,3,5-trienyl)-2-oxocyclohex-3-en-1-yl] hydrogen phosphate |
| SMILES | CCC=CC=C(C)C=CC1=C(C)C(=O)C(OP(=O)(O)OC[C@H](O)[C@H]2OC(=O)C(O)C2=O)CC1(C)C |
| InChI | InChI=1S/C24H33O10P/c1-6-7-8-9-14(2)10-11-16-15(3)19(26)18(12-24(16,4)5)34-35(30,31)32-13-17(25)22-20(27)21(28)23(29)33-22/h7-11,17-18,21-22,25,28H,6,12-13H2,1-5H3,(H,30,31)/t17-,18?,21?,22+/m0/s1 |
| InChIKey | VARANNCTTYKFOP-UKLGZHLBSA-N |
| XLogP | 2.49 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|