C26H37O9P — CID 91584972
[4-(3,7-dimethylnona-1,3,5,7-tetraenyl)-3,5,5-trimethylcyclohex-2-en-1-yl] [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] hydrogen phosphate (PubChem CID 91584972) has the molecular formula C26H37O9P and a molecular weight of 524.55 g/mol. Its IUPAC name is [4-(3,7-dimethylnona-1,3,5,7-tetraenyl)-3,5,5-trimethylcyclohex-2-en-1-yl] [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] hydrogen phosphate.
| Compound Name | [4-(3,7-dimethylnona-1,3,5,7-tetraenyl)-3,5,5-trimethylcyclohex-2-en-1-yl] [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] hydrogen phosphate |
|---|---|
| PubChem CID | 91584972 |
| Molecular Formula | C26H37O9P |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | [4-(3,7-dimethylnona-1,3,5,7-tetraenyl)-3,5,5-trimethylcyclohex-2-en-1-yl] [(2S)-2-hydroxy-2-[(2R)-4-hydroxy-3,5-dioxooxolan-2-yl]ethyl] hydrogen phosphate |
| SMILES | CC=C(C)C=CC=C(C)C=CC1C(C)=CC(OP(=O)(O)OC[C@H](O)[C@H]2OC(=O)C(O)C2=O)CC1(C)C |
| InChI | InChI=1S/C26H37O9P/c1-7-16(2)9-8-10-17(3)11-12-20-18(4)13-19(14-26(20,5)6)35-36(31,32)33-15-21(27)24-22(28)23(29)25(30)34-24/h7-13,19-21,23-24,27,29H,14-15H2,1-6H3,(H,31,32)/t19?,20?,21-,23?,24+/m0/s1 |
| InChIKey | OPXAJFRQHSCQIN-ANBONQJXSA-N |
| XLogP | 3.72 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|