C29H39O9P — CID 91356831
[4-(3,7-dimethylundeca-1,3,5,7,9-pentaenyl)-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] [(2R)-2-hydroxy-2-[(1R)-4-hydroxy-2,3-dioxocyclopentyl]ethyl] hydrogen phosphate (PubChem CID 91356831) has the molecular formula C29H39O9P and a molecular weight of 562.60 g/mol. Its IUPAC name is [4-(3,7-dimethylundeca-1,3,5,7,9-pentaenyl)-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] [(2R)-2-hydroxy-2-[(1R)-4-hydroxy-2,3-dioxocyclopentyl]ethyl] hydrogen phosphate.
| Compound Name | [4-(3,7-dimethylundeca-1,3,5,7,9-pentaenyl)-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] [(2R)-2-hydroxy-2-[(1R)-4-hydroxy-2,3-dioxocyclopentyl]ethyl] hydrogen phosphate |
|---|---|
| PubChem CID | 91356831 |
| Molecular Formula | C29H39O9P |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | [4-(3,7-dimethylundeca-1,3,5,7,9-pentaenyl)-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] [(2R)-2-hydroxy-2-[(1R)-4-hydroxy-2,3-dioxocyclopentyl]ethyl] hydrogen phosphate |
| SMILES | CC=CC=C(C)C=CC=C(C)C=CC1=C(C)C(=O)C(OP(=O)(O)OC[C@H](O)[C@H]2CC(O)C(=O)C2=O)CC1(C)C |
| InChI | InChI=1S/C29H39O9P/c1-7-8-10-18(2)11-9-12-19(3)13-14-22-20(4)26(32)25(16-29(22,5)6)38-39(35,36)37-17-24(31)21-15-23(30)28(34)27(21)33/h7-14,21,23-25,30-31H,15-17H2,1-6H3,(H,35,36)/t21-,23?,24+,25?/m1/s1 |
| InChIKey | HBPBUGYLVCXYQF-DBVFUXSZSA-N |
| XLogP | 4.27 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|