C8H12N3Na3O4 — CID 58730168
trisodium;2-[3-(carboxylatomethyl)-5-methanidyl-1,3,5-triazinan-1-yl]acetate (PubChem CID 58730168) has the molecular formula C8H12N3Na3O4 and a molecular weight of 283.17 g/mol. Its IUPAC name is trisodium;2-[3-(carboxylatomethyl)-5-methanidyl-1,3,5-triazinan-1-yl]acetate.
| Compound Name | trisodium;2-[3-(carboxylatomethyl)-5-methanidyl-1,3,5-triazinan-1-yl]acetate |
|---|---|
| PubChem CID | 58730168 |
| Molecular Formula | C8H12N3Na3O4 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | trisodium;2-[3-(carboxylatomethyl)-5-methanidyl-1,3,5-triazinan-1-yl]acetate |
| SMILES | [CH2-]N1CN(CC(=O)[O-])CN(CC(=O)[O-])C1.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C8H14N3O4.3Na/c1-9-4-10(2-7(12)13)6-11(5-9)3-8(14)15;;;/h1-6H2,(H,12,13)(H,14,15);;;/q-1;3*+1/p-2 |
| InChIKey | SOQAUMADNWTIMY-UHFFFAOYSA-L |
| XLogP | -12.92 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | -12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|