About [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate
[(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate (PubChem CID 58730218) has the molecular formula C10H21NO5S
and a molecular weight of 267.35 g/mol. Its IUPAC name is [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate.
Molecular Properties
| Compound Name | [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate |
| PubChem CID | 58730218 |
| Molecular Formula | C10H21NO5S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate |
| SMILES | CNC(COC)[C@@H](/C=C/COS(C)(=O)=O)OC |
| InChI | InChI=1S/C10H21NO5S/c1-11-9(8-14-2)10(15-3)6-5-7-16-17(4,12)13/h5-6,9-11H,7-8H2,1-4H3/b6-5+/t9?,10-/m1/s1 |
| InChIKey | RYMGJOYNFNSJMT-FLCPJYLTSA-N |
| XLogP | -0.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate?
The IUPAC name of [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate (CID 58730218) is [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate.
What is the SMILES notation for [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate?
The canonical SMILES for [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate is CNC(COC)[C@@H](/C=C/COS(C)(=O)=O)OC.
What is the InChIKey of [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate?
The InChIKey is RYMGJOYNFNSJMT-FLCPJYLTSA-N. The full InChI is InChI=1S/C10H21NO5S/c1-11-9(8-14-2)10(15-3)6-5-7-16-17(4,12)13/h5-6,9-11H,7-8H2,1-4H3/b6-5+/t9?,10-/m1/s1.
What are the key properties of [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate?
[(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate has a molecular weight of 267.35 g/mol, XLogP of -0.23, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,4R)-4,6-dimethoxy-5-(methylamino)hex-2-enyl] methanesulfonate is sourced from PubChem (CID 58730218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).