C10H21NO3 — CID 58730223
(E,3R)-1,3,6-trimethoxy-N-methylhex-4-en-2-amine (PubChem CID 58730223) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is (E,3R)-1,3,6-trimethoxy-N-methylhex-4-en-2-amine.
| Compound Name | (E,3R)-1,3,6-trimethoxy-N-methylhex-4-en-2-amine |
|---|---|
| PubChem CID | 58730223 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (E,3R)-1,3,6-trimethoxy-N-methylhex-4-en-2-amine |
| SMILES | CNC(COC)[C@@H](/C=C/COC)OC |
| InChI | InChI=1S/C10H21NO3/c1-11-9(8-13-3)10(14-4)6-5-7-12-2/h5-6,9-11H,7-8H2,1-4H3/b6-5+/t9?,10-/m1/s1 |
| InChIKey | LJNPWCIQTKQTKT-FLCPJYLTSA-N |
| XLogP | 0.44 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|