C8H17NO2 — CID 91346036
2-(methylamino)hept-4-ene-1,3-diol (PubChem CID 91346036) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-(methylamino)hept-4-ene-1,3-diol.
| Compound Name | 2-(methylamino)hept-4-ene-1,3-diol |
|---|---|
| PubChem CID | 91346036 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 2-(methylamino)hept-4-ene-1,3-diol |
| SMILES | CCC=CC(O)C(CO)NC |
| InChI | InChI=1S/C8H17NO2/c1-3-4-5-8(11)7(6-10)9-2/h4-5,7-11H,3,6H2,1-2H3 |
| InChIKey | YDJIXDOIBPSWBP-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|