C6H11NO2 — CID 70687364
(2R,3R)-2-(hydroxymethyl)-1,2,3,6-tetrahydropyridin-3-ol (PubChem CID 70687364) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is (2R,3R)-2-(hydroxymethyl)-1,2,3,6-tetrahydropyridin-3-ol.
| Compound Name | (2R,3R)-2-(hydroxymethyl)-1,2,3,6-tetrahydropyridin-3-ol |
|---|---|
| PubChem CID | 70687364 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | (2R,3R)-2-(hydroxymethyl)-1,2,3,6-tetrahydropyridin-3-ol |
| SMILES | OC[C@H]1NCC=C[C@H]1O |
| InChI | InChI=1S/C6H11NO2/c8-4-5-6(9)2-1-3-7-5/h1-2,5-9H,3-4H2/t5-,6-/m1/s1 |
| InChIKey | IIZFBLMFSCOJPJ-PHDIDXHHSA-N |
| XLogP | -1.13 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|