C10H19NO3 — CID 58730200
(E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enal (PubChem CID 58730200) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enal.
| Compound Name | (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enal |
|---|---|
| PubChem CID | 58730200 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enal |
| SMILES | CNC(COC)[C@@H](/C=C/CC=O)OC |
| InChI | InChI=1S/C10H19NO3/c1-11-9(8-13-2)10(14-3)6-4-5-7-12/h4,6-7,9-11H,5,8H2,1-3H3/b6-4+/t9?,10-/m1/s1 |
| InChIKey | XGRMJSDPFJQGRI-KFCHPMLTSA-N |
| XLogP | 0.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|