(E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid

C10H19NO4 — CID 58730192

IUPAC(E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid
SMILESCNC(COC)[C@@H](/C=C/CC(=O)O)OC
InChIInChI=1S/C10H19NO4/c1-11-8(7-14-2)9(15-3)5-4-6-10(12)13/h4-5,8-9,11H,6-7H2,1-3H3,(H,12,13)/b5-4+/t8?,9-/m1/s1
InChIKeyUPEOVWKGGBKUND-HOLAURBTSA-N
MW217.26 g/mol
LogP0.27
Rot. Bonds8

About (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid

(E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid (PubChem CID 58730192) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid.

Molecular Properties

Compound Name(E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid
PubChem CID58730192
Molecular FormulaC10H19NO4
Molecular Weight217.26 g/mol
Exact Mass217.13
IUPAC Name(E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid
SMILESCNC(COC)[C@@H](/C=C/CC(=O)O)OC
InChIInChI=1S/C10H19NO4/c1-11-8(7-14-2)9(15-3)5-4-6-10(12)13/h4-5,8-9,11H,6-7H2,1-3H3,(H,12,13)/b5-4+/t8?,9-/m1/s1
InChIKeyUPEOVWKGGBKUND-HOLAURBTSA-N
XLogP0.27
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.26
LogP ≤ 50.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid?
The IUPAC name of (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid (CID 58730192) is (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid.
What is the SMILES notation for (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid?
The canonical SMILES for (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid is CNC(COC)[C@@H](/C=C/CC(=O)O)OC.
What is the InChIKey of (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid?
The InChIKey is UPEOVWKGGBKUND-HOLAURBTSA-N. The full InChI is InChI=1S/C10H19NO4/c1-11-8(7-14-2)9(15-3)5-4-6-10(12)13/h4-5,8-9,11H,6-7H2,1-3H3,(H,12,13)/b5-4+/t8?,9-/m1/s1.
What are the key properties of (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid?
(E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid has a molecular weight of 217.26 g/mol, XLogP of 0.27, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid is sourced from PubChem (CID 58730192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).