C10H19NO4 — CID 58730192
(E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid (PubChem CID 58730192) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid.
| Compound Name | (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid |
|---|---|
| PubChem CID | 58730192 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid |
| SMILES | CNC(COC)[C@@H](/C=C/CC(=O)O)OC |
| InChI | InChI=1S/C10H19NO4/c1-11-8(7-14-2)9(15-3)5-4-6-10(12)13/h4-5,8-9,11H,6-7H2,1-3H3,(H,12,13)/b5-4+/t8?,9-/m1/s1 |
| InChIKey | UPEOVWKGGBKUND-HOLAURBTSA-N |
| XLogP | 0.27 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|