C19H39N3O6 — CID 91415509
(E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid;(E,4R)-4,6-dimethoxy-5-N-methylhex-2-ene-1,5-diamine (PubChem CID 91415509) has the molecular formula C19H39N3O6 and a molecular weight of 405.54 g/mol. Its IUPAC name is (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid;(E,4R)-4,6-dimethoxy-5-N-methylhex-2-ene-1,5-diamine.
| Compound Name | (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid;(E,4R)-4,6-dimethoxy-5-N-methylhex-2-ene-1,5-diamine |
|---|---|
| PubChem CID | 91415509 |
| Molecular Formula | C19H39N3O6 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | (E,5R)-5,7-dimethoxy-6-(methylamino)hept-3-enoic acid;(E,4R)-4,6-dimethoxy-5-N-methylhex-2-ene-1,5-diamine |
| SMILES | CNC(COC)[C@@H](/C=C/CC(=O)O)OC.CNC(COC)[C@@H](/C=C/CN)OC |
| InChI | InChI=1S/C10H19NO4.C9H20N2O2/c1-11-8(7-14-2)9(15-3)5-4-6-10(12)13;1-11-8(7-12-2)9(13-3)5-4-6-10/h4-5,8-9,11H,6-7H2,1-3H3,(H,12,13);4-5,8-9,11H,6-7,10H2,1-3H3/b2*5-4+/t2*8?,9-/m11/s1 |
| InChIKey | QKRHYCJWLDTTSB-TXRDTPQOSA-N |
| XLogP | 0.02 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|