C12H21NO5 — CID 89222751
4-[(E,2S,3S)-2-(ethylamino)-3-hydroxyhex-4-enoxy]-4-oxobutanoic acid (PubChem CID 89222751) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is 4-[(E,2S,3S)-2-(ethylamino)-3-hydroxyhex-4-enoxy]-4-oxobutanoic acid.
| Compound Name | 4-[(E,2S,3S)-2-(ethylamino)-3-hydroxyhex-4-enoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89222751 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-[(E,2S,3S)-2-(ethylamino)-3-hydroxyhex-4-enoxy]-4-oxobutanoic acid |
| SMILES | C/C=C/[C@H](O)[C@H](COC(=O)CCC(=O)O)NCC |
| InChI | InChI=1S/C12H21NO5/c1-3-5-10(14)9(13-4-2)8-18-12(17)7-6-11(15)16/h3,5,9-10,13-14H,4,6-8H2,1-2H3,(H,15,16)/b5-3+/t9-,10-/m0/s1 |
| InChIKey | YFYQYENZRKCFMM-GMRPRLDHSA-N |
| XLogP | 0.31 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|