C10H19NaO4 — CID 174966699
sodium;4-(2,3-dimethylbutoxy)-4-oxobutanoic acid;hydride (PubChem CID 174966699) has the molecular formula C10H19NaO4 and a molecular weight of 226.25 g/mol. Its IUPAC name is sodium;4-(2,3-dimethylbutoxy)-4-oxobutanoic acid;hydride.
| Compound Name | sodium;4-(2,3-dimethylbutoxy)-4-oxobutanoic acid;hydride |
|---|---|
| PubChem CID | 174966699 |
| Molecular Formula | C10H19NaO4 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | sodium;4-(2,3-dimethylbutoxy)-4-oxobutanoic acid;hydride |
| SMILES | CC(C)C(C)COC(=O)CCC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C10H18O4.Na.H/c1-7(2)8(3)6-14-10(13)5-4-9(11)12;;/h7-8H,4-6H2,1-3H3,(H,11,12);;/q;+1;-1 |
| InChIKey | RVICATRBANNYLV-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |